| 2-chloro-4-(4-chlorophenoxy)acetophenone | |
| Structural formula |
|
| Uses |
An important organic synthetic raw material and pharmaceutical intermediates, with a wide range of applications, can be used in perfumes especially preparation of soap and perfume rose hybrid spices can also be used for synthetic resin, synthetic organic materials, high-temperature organic heat carrier. |
| Molecular formula |
C14H10Cl2O2 |
| Molecular weight | 281.134 |
| CAS | 119851-28-4 |
| EINECS RN | |
| InChI | InChI=1/C14H10Cl2O2/c1-9(17)13-7-6-12(8-14(13)16)18-11-4-2-10(15)3-5-11/h2-8H,1H3 |
| Appearance | Colorless to light yellow liquid |
| Boiling point(101.3kPa) | 369.2℃ at 760 mmHg |
| Freezing point | |
| Specific gravity(25℃/4℃) | |
| Refractive index(25℃) | 1.588 |
| Flash point | 146.5℃ |
| Melting point | 54-56℃ |
| Density | 1.29g/mL |
| Surface tension（mN/M）20℃ | |
| Solubility | |
| Viscosity(20℃) | |
| Chemical properties |
stable properties, insoluble in water, soluble in benzene, chlorobenzene and other organic solvents |
| Purity(GC)% | |
| Moisture% | |
| Acidity(as HAC)% | |
| Peroxide(as H2O2)% | |
| Packing | 250kg |
